Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Formula: C8H3N3O2, 31643-49-9, Name is 4-Nitrophthalonitrile, SMILES is C1=C(C(=CC=C1[N+](=O)[O-])C#N)C#N, belongs to nitriles-buliding-blocks compound. In a document, author is Shahiri-Haghayegh, Mehran, introduce the new discover.
Greener and Additive-Free Ring Opening of Epoxides by All-in-One Choline Systems
Adaptation of all-in-one ionic systems with ionic liquids (ILs) serving as solvent, reactant, and catalyst is an innovative approach in the organic synthesis. Mild and bio clean choline based ILs as all-in-one systems (solvent, reagent, and catalyst) were developed via a simple metathesis approach and were applied on the ring-opening reaction of epoxides. Sustained transformation of various epoxides using choline cyanide, azide, and hydroxide ILs delivered a neat, efficient and convenient protocol for the synthesis of beta-substituted alcohols in moderate to high yields (64-97 %) with excellent activity and selectivity as confirmed by nuclear magnetic resonance (NMR) spectroscopic data.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 31643-49-9. Formula: C8H3N3O2.